1,3-Diaminoguanidine monohydrochloride
- Product Name1,3-Diaminoguanidine monohydrochloride
- CAS36062-19-8
- MFCH8ClN5
- MW125.56
- EINECS252-854-0
- MOL File36062-19-8.mol
Chemical Properties
| Melting point | 180-182 °C (dec.)(lit.) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | water: soluble50mg/mL, clear to very slightly hazy, colorless to faintly yellow |
| form | Granular Powder |
| color | White to light beige |
| Water Solubility | very faint turbidity |
| Sensitive | Hygroscopic |
| BRN | 3556702 |
| InChI | InChI=1S/CH7N5.ClH/c2-1(5-3)6-4;/h3-4H2,(H3,2,5,6);1H |
| InChIKey | HAZRIBSLCUYMQP-UHFFFAOYSA-N |
| SMILES | C(=N)(NN)NN.Cl |
| CAS DataBase Reference | 36062-19-8(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-36-24/25 |
| WGK Germany | 3 |
| HS Code | 29212900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
