| Boiling point |
218-220 °C (lit.) |
| Density |
1.273 g/mL at 25 °C (lit.) |
| vapor pressure |
0-4220000Pa at 20-25℃ |
| refractive index |
n20/D 1.5240(lit.) |
| Flash point |
210 °F |
| storage temp. |
Store at room temperature, keep dry and cool |
| form |
liquid |
| Specific Gravity |
1.28 |
| Appearance |
Colorless to light yellow Liquid |
| Water Solubility |
Reacts with water. |
| Hydrolytic Sensitivity |
8: reacts rapidly with moisture, water, protic solvents |
| Sensitive |
Moisture Sensitive |
| BRN |
1866557 |
| InChI |
1S/C7H7Cl3Si/c1-6-2-4-7(5-3-6)11(8,9)10/h2-5H,1H3 |
| InChIKey |
WOMUGKOOLXQCTQ-UHFFFAOYSA-N |
| SMILES |
Cc1ccc(cc1)[Si](Cl)(Cl)Cl |
| LogP |
-0.6 |
| CAS DataBase Reference |
701-35-9(CAS DataBase Reference) |
| NIST Chemistry Reference |
4-Tolyltrichlorosilane(701-35-9) |
| EPA Substance Registry System |
Silane, trichloro(4-methylphenyl)- (701-35-9) |
