Tapentadol O-β-D-Glucuronide
- Product NameTapentadol O-β-D-Glucuronide
- CAS1300037-86-8
- MFC20H31NO7
- MW397.46264
- EINECS
- MOL File1300037-86-8.mol
Chemical Properties
| Melting point | >170°C (dec.) |
| Flash point | 13℃ |
| storage temp. | Hygroscopic, -20°C Freezer, Under Inert Atmosphere |
| solubility | Methanol (Slightly), Water (Slightly) |
| form | Solid |
| color | White to Off-White |
| Major Application | forensics and toxicology |
| InChIKey | CTYJDHSTNLOUMT-PJOQTPGLSA-N |
| SMILES | CC[C@H]([C@@H](C)CN(C)C)c1cccc(O[C@@H]2O[C@@H]([C@@H](O)[C@H](O)[C@H]2O)C(O)=O)c1 |
Safety Information
| Hazard Codes | F,Xn |
| Risk Statements | 11-20/21/22-36 |
| Safety Statements | 16-26-36/37 |
| RIDADR | UN 1648 3 / PGII |
| WGK Germany | 2 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Flam. Liq. 2 |