2,3-Dichlorobenzoyl chloride
- Product Name2,3-Dichlorobenzoyl chloride
- CAS2905-60-4
- MFC7H3Cl3O
- MW209.46
- EINECS220-811-5
- MOL File2905-60-4.mol
Chemical Properties
| Melting point | 30-32°C |
| Boiling point | 140°C 14mm |
| Density | 1.498±0.06 g/cm3(Predicted) |
| Flash point | 167°C |
| solubility | soluble in Toluene |
| form | powder to lump to clear liquid |
| color | White or Colorless to Light yellow |
| Sensitive | Moisture Sensitive |
| BRN | 2575973 |
| InChI | InChI=1S/C7H3Cl3O/c8-5-3-1-2-4(6(5)9)7(10)11/h1-3H |
| InChIKey | YBONBWJSFMTXLE-UHFFFAOYSA-N |
| SMILES | C(Cl)(=O)C1=CC=CC(Cl)=C1Cl |
| CAS DataBase Reference | 2905-60-4(CAS DataBase Reference) |
| EPA Substance Registry System | Benzoyl chloride, 2,3-dichloro- (2905-60-4) |
Safety Information
| Hazard Codes | C,Xn |
| Risk Statements | 34-22 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | 3261 |
| WGK Germany | 1 |
| Hazard Note | Corrosive |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29163990 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Eye Dam. 1 Skin Corr. 1B |
| Hazardous Substances Data | 2905-60-4(Hazardous Substances Data) |
