5-Chloro-2-methylene-1,3,3-trimethylindoline
- Product Name5-Chloro-2-methylene-1,3,3-trimethylindoline
- CAS6872-17-9
- MFC12H14ClN
- MW207.7
- EINECS229-972-6
- MOL File6872-17-9.mol
Chemical Properties
| Boiling point | 139 °C / 11mmHg |
| Density | 1.083 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | >230 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| form | clear liquid |
| pka | 1.12±0.40(Predicted) |
| Specific Gravity | 1.083 |
| color | Orange to Brown to Dark purple |
| InChI | 1S/C12H14ClN/c1-8-12(2,3)10-7-9(13)5-6-11(10)14(8)4/h5-7H,1H2,2-4H3 |
| InChIKey | VDMXGJJMPKAYQP-UHFFFAOYSA-N |
| SMILES | CN1C(=C)C(C)(C)c2cc(Cl)ccc12 |
| CAS DataBase Reference | 6872-17-9(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HS Code | 29339900 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
