| Boiling point |
236°C |
| Density |
0,88 g/cm3 |
| vapor pressure |
0-7910Pa at 25℃ |
| refractive index |
1.4160 |
| Flash point |
>40°C |
| form |
clear liquid |
| Specific Gravity |
0.880 |
| color |
Colorless to Light yellow |
| Water Solubility |
100-1000000000μg/L at 20℃ |
| Hydrolytic Sensitivity |
7: reacts slowly with moisture/water |
| InChI |
InChI=1S/C14H32O3Si/c1-8-15-18(16-9-2,17-10-3)12-13(4)11-14(5,6)7/h13H,8-12H2,1-7H3 |
| InChIKey |
UWZSHGZRSZICIW-UHFFFAOYSA-N |
| SMILES |
[Si](OCC)(OCC)(OCC)CC(C)CC(C)(C)C |
| LogP |
-0.3-6.5 at 20℃ |
| CAS DataBase Reference |
35435-21-3(CAS DataBase Reference) |
| EPA Substance Registry System |
Silane, triethoxy(2,4,4-trimethylpentyl)- (35435-21-3) |
