| Boiling point |
101 °C37 mm Hg(lit.) |
| Density |
1.60 g/mL at 20 °C |
| refractive index |
n20/D 1.492(lit.) |
| Flash point |
91 °C |
| storage temp. |
Inert atmosphere,Room Temperature |
| form |
Liquid |
| color |
Clear colorless to slightly yellow or light pink |
| Water Solubility |
Miscible with organic solvents. Immiscible with water. |
| Sensitive |
Moisture Sensitive |
| BRN |
1743026 |
| InChI |
InChI=1S/C4H6BrClO/c5-3-1-2-4(6)7/h1-3H2 |
| InChIKey |
LRTRXDSAJLSRTG-UHFFFAOYSA-N |
| SMILES |
C(Cl)(=O)CCCBr |
| CAS DataBase Reference |
927-58-2(CAS DataBase Reference) |
| NIST Chemistry Reference |
Butanoyl chloride, 4-bromo-(927-58-2) |
| EPA Substance Registry System |
Butanoyl chloride, 4-bromo- (927-58-2) |
