3,3-DIMETHYLGLUTARIMIDE
- Product Name3,3-DIMETHYLGLUTARIMIDE
- CAS1123-40-6
- MFC7H11NO2
- MW141.17
- EINECS214-373-4
- MOL File1123-40-6.mol
Chemical Properties
| Melting point | 144-146 °C (lit.) |
| Boiling point | 258.21°C (rough estimate) |
| Density | 1.1522 (rough estimate) |
| refractive index | 1.5026 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | 11.81±0.40(Predicted) |
| form | powder to crystal |
| color | White to Almost white |
| Water Solubility | Soluble in water. |
| BRN | 111981 |
| InChI | InChI=1S/C7H11NO2/c1-7(2)3-5(9)8-6(10)4-7/h3-4H2,1-2H3,(H,8,9,10) |
| InChIKey | YUJCWMGBRDBPDL-UHFFFAOYSA-N |
| SMILES | N1C(=O)CC(C)(C)CC1=O |
| CAS DataBase Reference | 1123-40-6(CAS DataBase Reference) |
| NIST Chemistry Reference | 2,6-Piperidinedione, 4,4-dimethyl-(1123-40-6) |
| EPA Substance Registry System | 3,3-Dimethylglutarimide (1123-40-6) |
Safety Information
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37/38-43 |
| Safety Statements | 26-36/37-22 |
| RIDADR | 2811 |
| WGK Germany | 2 |
| RTECS | MA4348000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29251995 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |
