PONCEAU SX
- Product NamePONCEAU SX
- CAS4548-53-2
- MFC18H17N2NaO7S2
- MW460.45
- EINECS224-909-9
- MOL File4548-53-2.mol
Chemical Properties
| Melting point | >300℃ |
| Density | 0.272[at 20℃] |
| solubility | Soluble in water, ethanol |
| Colour Index | 14700 |
| form | crystals |
| color | Red |
| Water Solubility | 130.4g/L at 30℃ |
| λmax | 500 nm |
| Merck | 14,7591 |
| BRN | 7161700 |
| Biological Applications | Detecting proteins; treating acquired resistance to GABAergic (ARG) agents; Shampoos; soaps |
| Major Application | cleaning products cosmetics food and beverages personal care |
| Cosmetics Ingredients Functions | COLORANT HAIR DYEING |
| InChIKey | ONTQJDKFANPPKK-LLIZZRELSA-L |
| SMILES | [Na+].[Na+].Cc1cc(C)c(cc1\N=N\c2cc(c3ccccc3c2O)S([O-])(=O)=O)S([O-])(=O)=O |
| LogP | -0.083 |
| CAS DataBase Reference | 4548-53-2(CAS DataBase Reference) |
| IARC | 3 (Vol. 8, Sup 7) 1987 |
Safety Information
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| RTECS | QK2705000 |
| TSCA | TSCA listed |
| HS Code | 32041200 |
| Storage Class | 11 - Combustible Solids |
| Toxicity | LD50 orally in rats: >2 g/kg (Lu, Lavalle) |
