| Melting point |
57-60 °C (dec.)(lit.) |
| Boiling point |
158 °C0.2 mm Hg(lit.) |
| alpha |
-21 º (c=10, H2O) |
| Density |
1.30 |
| refractive index |
-21 ° (C=1, H2O) |
| Flash point |
>230 °F |
| storage temp. |
Inert atmosphere,Room Temperature |
| pka |
11.44±0.20(Predicted) |
| form |
powder to crystal |
| color |
White to Almost white |
| optical activity |
[α]20/D 21°, c = 2.5 in H2O |
| BRN |
1726254 |
| InChI |
InChI=1S/C6H10O6/c1-11-5(9)3(7)4(8)6(10)12-2/h3-4,7-8H,1-2H3/t3-,4-/m0/s1 |
| InChIKey |
PVRATXCXJDHJJN-IMJSIDKUSA-N |
| SMILES |
C(OC)(=O)[C@@H](O)[C@H](O)C(OC)=O |
| CAS DataBase Reference |
13171-64-7(CAS DataBase Reference) |
| NIST Chemistry Reference |
(-)-Dimethyl D-tartrate(13171-64-7) |
