1-Bromo-4-chloro-2-methylbenzene
- Product Name1-Bromo-4-chloro-2-methylbenzene
- CAS14495-51-3
- MFC7H6BrCl
- MW205.48
- EINECS238-503-4
- MOL File14495-51-3.mol
Chemical Properties
| Boiling point | 98-100 °C (25 mmHg) |
| Density | 1.543 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | 204 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| Water Solubility | INSOLUBLE |
| BRN | 2500157 |
| InChI | InChI=1S/C7H6BrCl/c1-5-4-6(9)2-3-7(5)8/h2-4H,1H3 |
| InChIKey | RTIPTGMVQIIMKL-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC=C(Cl)C=C1C |
| CAS DataBase Reference | 14495-51-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 1-bromo-4-chloro-2-methyl-(14495-51-3) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29039990 |