| Melting point |
112-118 °C (lit.) |
| Boiling point |
236.5±35.0 °C(Predicted) |
| Density |
1.199±0.06 g/cm3(Predicted) |
| storage temp. |
2-8°C, protect from light, stored under nitrogen |
| solubility |
Chloroform, Methanol (Sparingly) |
| pka |
0.86±0.70(Predicted) |
| form |
powder to crystal |
| color |
Light orange to Yellow to Green |
| BRN |
2828017 |
| InChI |
InChI=1S/C4H8N2O2S/c1-5-4(9-2)3-6(7)8/h3,5H,1-2H3 |
| InChIKey |
YQFHPXZGXNYYLD-UHFFFAOYSA-N |
| SMILES |
C(NC)(SC)=C[N+]([O-])=O |
| CAS DataBase Reference |
61832-41-5(CAS DataBase Reference) |
| NIST Chemistry Reference |
Ethenamine, n-methyl-1-(methylthio)-2-nitro-(61832-41-5) |
