N-Methyl-1-(methylthio)-2-nitroethylen-1-amine
- Product NameN-Methyl-1-(methylthio)-2-nitroethylen-1-amine
- CAS61832-41-5
- MFC4H8N2O2S
- MW148.18
- EINECS263-266-9
- MOL File61832-41-5.mol
Chemical Properties
| Melting point | 112-118 °C (lit.) |
| Boiling point | 236.5±35.0 °C(Predicted) |
| Density | 1.199±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C, protect from light, stored under nitrogen |
| solubility | Chloroform, Methanol (Sparingly) |
| pka | 0.86±0.70(Predicted) |
| form | powder to crystal |
| color | Light orange to Yellow to Green |
| BRN | 2828017 |
| InChI | InChI=1S/C4H8N2O2S/c1-5-4(9-2)3-6(7)8/h3,5H,1-2H3 |
| InChIKey | YQFHPXZGXNYYLD-UHFFFAOYSA-N |
| SMILES | C(NC)(SC)=C[N+]([O-])=O |
| CAS DataBase Reference | 61832-41-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Ethenamine, n-methyl-1-(methylthio)-2-nitro-(61832-41-5) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| RIDADR | UN 3335 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29309090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
