Azidoacetic acid
- Product NameAzidoacetic acid
- CAS18523-48-3
- MFC2H3N3O2
- MW101.06
- EINECS
- MOL File18523-48-3.mol
Chemical Properties
| Melting point | 13-15°C |
| Boiling point | 98-100°C 0,1mm |
| Density | 1.350 g/mL at 25 °C |
| refractive index | n20/D1.472 |
| Flash point | >110℃ |
| Water Solubility | Soluble in water |
| form | powder to lump to clear liquid |
| color | Crystals or liquid |
| InChI | InChI=1S/C2H3N3O2/c3-5-4-1-2(6)7/h1H2,(H,6,7) |
| InChIKey | PPXUUPXQWDQNGO-UHFFFAOYSA-N |
| SMILES | C(N=[N+]=[N-])C(=O)O |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 2-5-11-36/37/38 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | 1993 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 2929.90.5090 |
