4-Methoxypyridine N-oxide
- Product Name4-Methoxypyridine N-oxide
- CAS1122-96-9
- MFC6H7NO2
- MW125.13
- EINECS214-367-1
- MOL File1122-96-9.mol
Chemical Properties
| Melting point | 73-79 °C |
| Boiling point | 308.9±15.0 °C(Predicted) |
| Density | 1.09±0.1 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | 2.30±0.10(Predicted) |
| form | powder to crystal |
| color | White to Yellow to Orange |
| Sensitive | Hygroscopic |
| λmax | 282nm(CH3CN)(lit.) |
| BRN | 115212 |
| InChI | InChI=1S/C6H7NO2/c1-9-6-2-4-7(8)5-3-6/h2-5H,1H3 |
| InChIKey | BOFAIBPJCWFJFT-UHFFFAOYSA-N |
| SMILES | C1[N+]([O-])=CC=C(OC)C=1 |
| CAS DataBase Reference | 1122-96-9(CAS DataBase Reference) |
| NIST Chemistry Reference | Pyridine, 4-methoxy-1-oxide-(1122-96-9) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-24/25-37 |
| WGK Germany | 3 |
| F | 3-10 |
| HS Code | 29333990 |
