2,5-Dibromobenzoic acid
- Product Name2,5-Dibromobenzoic acid
- CAS610-71-9
- MFC7H4Br2O2
- MW279.91
- EINECS210-234-7
- MOL File610-71-9.mol
Chemical Properties
| Melting point | 156-159 °C(lit.) |
| Boiling point | 344.6±32.0 °C(Predicted) |
| Density | 1.9661 (rough estimate) |
| refractive index | 1.4970 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 2.46±0.10(Predicted) |
| color | White to Yellow to Orange |
| BRN | 1868193 |
| Major Application | food and beverages |
| InChI | InChI=1S/C7H4Br2O2/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3H,(H,10,11) |
| InChIKey | SQQKOTVDGCJJKI-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC(Br)=CC=C1Br |
| CAS DataBase Reference | 610-71-9(CAS DataBase Reference) |
| NIST Chemistry Reference | 2,5-Dibromobenzoic acid(610-71-9) |
Safety Information
| Hazard Codes | Xi,C |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | DG6290000 |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |