| Melting point |
>250°C |
| Boiling point |
475.1±35.0 °C(Predicted) |
| Density |
1.367±0.06 g/cm3(Predicted) |
| storage temp. |
−20°C |
| solubility |
Solubility Insoluble in water; soluble in N, N-dimethylformamide, dimethyl sulfoxide |
| form |
Solid |
| pka |
8.6(at 25℃) |
| color |
Yellow |
| PH Range |
Weak blue B uorescence (7.5) to strong blue B uorescence (9.8) |
| Appearance |
Solid Powder |
| λmax |
412nm |
| Biological Applications |
Antimalarial; bactericidal; detection of cancer cells,nucleic acids; treating malformed proteins causing neurodegenerative disease |
| Major Application |
Sensors, detection method for DNA amplification, inhibition of neurode-generative diseases, RNA hydrolysis, fluorescent probes, primers for nucleic acid sequencing, synthesis of nucleic acids, antimalerial agent |
| SMILES |
ClC(C=CC1=C2N)=CC1=NC3=C2C=C(OC)C=C3 |
