2-Chloro-4-nitrobenzamide
- Product Name2-Chloro-4-nitrobenzamide
- CAS3011-89-0
- MFC7H5ClN2O3
- MW200.58
- EINECS221-143-7
- MOL File3011-89-0.mol
Chemical Properties
| Melting point | 171-173°C |
| Boiling point | 335.8±32.0 °C(Predicted) |
| Density | 1.520±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO: 250 mg/mL (1246.39 mM) |
| form | Solid |
| pka | 14.39±0.50(Predicted) |
| color | White to Light yellow |
| BRN | 1966537 |
| Major Application | forensics and toxicology pharmaceutical (small molecule) |
| InChI | 1S/C7H5ClN2O3/c8-6-3-4(10(12)13)1-2-5(6)7(9)11/h1-3H,(H2,9,11) |
| InChIKey | GFGSZUNNBQXGMK-UHFFFAOYSA-N |
| SMILES | NC(=O)c1ccc(cc1Cl)[N+]([O-])=O |
| CAS DataBase Reference | 3011-89-0(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Chloro-4-nitrobenzamide (3011-89-0) |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| Hazard Note | Harmful |
| HazardClass | IRRITANT |
| HS Code | 2924297099 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |