(2-Chloro-5-iodophenyl)[4-[[(3S)-tetrahydro-3-furanyl]oxy]phenyl]methanone
- Product Name(2-Chloro-5-iodophenyl)[4-[[(3S)-tetrahydro-3-furanyl]oxy]phenyl]methanone
- CAS915095-87-3
- MFC17H14ClIO3
- MW428.65
- EINECS619-598-5
- MOL File915095-87-3.mol
Chemical Properties
| Melting point | 109-113oC |
| Boiling point | 526℃ |
| Density | 1.639 |
| Flash point | 272℃ |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| solubility | Chloroform (Slightly), DMSO (Slightly), Ethyl Acetate (Slightly) |
| form | Solid |
| color | Off-White to Pale Beige |
| optical activity | Consistent with structure |
| InChI | InChI=1S/C17H14ClIO3/c18-16-6-3-12(19)9-15(16)17(20)11-1-4-13(5-2-11)22-14-7-8-21-10-14/h1-6,9,14H,7-8,10H2/t14-/m0/s1 |
| InChIKey | WBBJCIOCSVFCNI-AWEZNQCLSA-N |
| SMILES | C(C1=CC(I)=CC=C1Cl)(C1=CC=C(O[C@H]2CCOC2)C=C1)=O |
