| Melting point |
88-91 °C |
| Boiling point |
407.2±38.0 °C(Predicted) |
| Density |
1.182±0.06 g/cm3(Predicted) |
| refractive index |
142 ° (C=1, EtOH) |
| storage temp. |
Sealed in dry,2-8°C |
| solubility |
Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| Water Solubility |
Insoluble in water |
| form |
powder to crystal |
| pka |
3.51±0.10(Predicted) |
| color |
White to Almost white |
| optical activity |
[α]20/D +144±2°, c = 1% in ethanol |
| BRN |
3592362 |
| Major Application |
peptide synthesis |
| InChI |
InChI=1/C13H17NO4/c1-13(2,3)18-12(17)14-10(11(15)16)9-7-5-4-6-8-9/h4-8,10H,1-3H3,(H,14,17)(H,15,16)/t10-/s3 |
| InChIKey |
HOBFSNNENNQQIU-JQHDBZEONA-N |
| SMILES |
[C@H](C1C=CC=CC=1)(C(=O)O)NC(=O)OC(C)(C)C |&1:0,r| |
| CAS DataBase Reference |
2900-27-8(CAS DataBase Reference) |
