Ethyl 2-bromothiazole-4-carboxylate
- Product NameEthyl 2-bromothiazole-4-carboxylate
- CAS100367-77-9
- MFC6H6BrNO2S
- MW236.09
- EINECS
- MOL File100367-77-9.mol
Chemical Properties
| Melting point | 67-71 °C |
| Boiling point | 154°C/13mmHg(lit.) |
| Density | 1.654±0.06 g/cm3(Predicted) |
| Flash point | >110℃ |
| storage temp. | 2-8°C |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | -1.50±0.10(Predicted) |
| color | White to Almost white |
| Sensitive | Moisture & Light Sensitive |
| InChI | InChI=1S/C6H6BrNO2S/c1-2-10-5(9)4-3-11-6(7)8-4/h3H,2H2,1H3 |
| InChIKey | CNHISCQPKKGDPO-UHFFFAOYSA-N |
| SMILES | S1C=C(C(OCC)=O)N=C1Br |
| CAS DataBase Reference | 100367-77-9(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39-24/25 |
| WGK Germany | 2 |
| Hazard Note | Irritant/Keep Cold |
| HazardClass | IRRITANT |
| HS Code | 29341000 |
