Cyclopentene oxide
- Product NameCyclopentene oxide
- CAS285-67-6
- MFC5H8O
- MW84.12
- EINECS206-005-6
- MOL File285-67-6.mol
Chemical Properties
| Melting point | 136-137 °C |
| Boiling point | 102 °C(lit.) |
| Density | 0.964 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | 50 °F |
| storage temp. | 2-8°C |
| form | Liquid |
| color | Clear colorless to very faintly yellow |
| Water Solubility | Immiscible with water. |
| BRN | 102495 |
| InChI | InChI=1S/C5H8O/c1-2-4-5(3-1)6-4/h4-5H,1-3H2 |
| InChIKey | GJEZBVHHZQAEDB-UHFFFAOYSA-N |
| SMILES | C12C(O1)CCC2 |
| LogP | 0.908 (est) |
| CAS DataBase Reference | 285-67-6(CAS DataBase Reference) |
| NIST Chemistry Reference | cis-1,2-Epoxycyclopentane(285-67-6) |
| EPA Substance Registry System | 6-Oxabicyclo[3.1.0]hexane (285-67-6) |
Safety Information
| Hazard Codes | F,Xi |
| Risk Statements | 11-36/37/38 |
| Safety Statements | 16-26-36-36/37/39 |
| RIDADR | UN 1993 3/PG 2 |
| WGK Germany | 3 |
| RTECS | RN8935000 |
| TSCA | TSCA listed |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29109000 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 2 Skin Irrit. 2 STOT SE 3 |
| Hazardous Substances Data | 285-67-6(Hazardous Substances Data) |
