| Melting point |
136-137 °C |
| Boiling point |
102 °C(lit.) |
| Density |
0.964 g/mL at 25 °C(lit.) |
| refractive index |
n20/D 1.434(lit.) |
| Flash point |
50 °F |
| storage temp. |
2-8°C |
| form |
Liquid |
| color |
Clear colorless to very faintly yellow |
| Water Solubility |
Immiscible with water. |
| BRN |
102495 |
| InChI |
InChI=1S/C5H8O/c1-2-4-5(3-1)6-4/h4-5H,1-3H2 |
| InChIKey |
GJEZBVHHZQAEDB-UHFFFAOYSA-N |
| SMILES |
C12C(O1)CCC2 |
| LogP |
0.908 (est) |
| CAS DataBase Reference |
285-67-6(CAS DataBase Reference) |
| NIST Chemistry Reference |
cis-1,2-Epoxycyclopentane(285-67-6) |
| EPA Substance Registry System |
6-Oxabicyclo[3.1.0]hexane (285-67-6) |
