4'-Chloro-biphenyl-2-ylamine
- Product Name4'-Chloro-biphenyl-2-ylamine
- CAS1204-44-0
- MFC12H10ClN
- MW203.67
- EINECS601-706-7
- MOL File1204-44-0.mol
Chemical Properties
| Melting point | 45.0 to 49.0 °C |
| Boiling point | 334.6±17.0 °C(Predicted) |
| Density | 1.205±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 3.26±0.10(Predicted) |
| color | Off-White to Pale Beige |
| InChI | InChI=1S/C12H10ClN/c13-10-7-5-9(6-8-10)11-3-1-2-4-12(11)14/h1-8H,14H2 |
| InChIKey | JPBWZIPCMDZOPM-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=C(Cl)C=C2)=CC=CC=C1N |
| CAS DataBase Reference | 1204-44-0(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| Hazard Note | Irritant |
| HS Code | 2921490090 |
