N,N-Bis(2-chloroethyl)carbamoyl chloride
- Product NameN,N-Bis(2-chloroethyl)carbamoyl chloride
- CAS2998-56-3
- MFC5H8Cl3NO
- MW204.48
- EINECS221-075-8
- MOL File2998-56-3.mol
Chemical Properties
| Melting point | 101-103 °C |
| Boiling point | 125°C 3mm |
| Density | 1,4 g/cm3 |
| refractive index | 1.5060-1.5100 |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | -2.30±0.70(Predicted) |
| form | clear liquid |
| color | Colorless to Light yellow |
| InChI | InChI=1S/C5H8Cl3NO/c6-1-3-9(4-2-7)5(8)10/h1-4H2 |
| InChIKey | JAHXVUPWHXMPLG-UHFFFAOYSA-N |
| SMILES | C(Cl)(=O)N(CCCl)CCCl |
Safety Information
| Hazard Codes | T |
| Risk Statements | 34-43-25 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | 3265 |
| RTECS | FD2200000 |
| HS Code | 2929.90.5090 |
| HazardClass | 8 |
| PackingGroup | II |
| Toxicity | mouse,LC,inhalation,> 1540mg/m3/10 (1540mg/m3),National Defense Research Committee, Office of Scientific Research and Development, Progress Report.Vol. NDCrc-132, Pg. Nov, 1942. |