Chemical Properties
| Melting point | 186°C |
| Boiling point | 397.8°C (rough estimate) |
| Density | 1.2628 (rough estimate) |
| refractive index | 1.4430 (estimate) |
| storage temp. | -20°C |
| solubility | DMSO: 10 mM |
| form | A solid |
| pka | 12.81±0.70(Predicted) |
| color | White to off-white |
| Water Solubility | 4.975g/L(cold water) |
| Major Application | metabolomics vitamins, nutraceuticals, and natural products |
| InChI | 1S/C16H22O8/c1-22-11-7-9(3-2-6-17)4-5-10(11)23-16-15(21)14(20)13(19)12(8-18)24-16/h2,4-7,12-21H,3,8H2,1H3/b6-2+/t12-,13-,14+,15-,16-/m1/s1 |
| InChIKey | XQIJIPVRXMWYLN-GLIXSRQJSA-N |
| SMILES | COc1cc(C\C=C\O)ccc1O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O |
| LogP | -1.510 (est) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 |
