(R)-(-)-1-Benzyl-3-hydroxypiperidine
- Product Name(R)-(-)-1-Benzyl-3-hydroxypiperidine
- CAS91599-81-4
- MFC12H17NO
- MW191.27
- EINECS
- MOL File91599-81-4.mol
Chemical Properties
| alpha | -12 º (C=1 IN MEOH) |
| Boiling point | 275 °C (lit.) |
| Density | 1.07 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | >230 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | clear liquid |
| pka | 14.82±0.20(Predicted) |
| color | Light orange to Yellow to Green |
| optical activity | [α]24/D 12°, c = 1 in methanol |
| InChI | InChI=1S/C12H17NO/c14-12-7-4-8-13(10-12)9-11-5-2-1-3-6-11/h1-3,5-6,12,14H,4,7-10H2/t12-/m1/s1 |
| InChIKey | UTTCOAGPVHRUFO-GFCCVEGCSA-N |
| SMILES | N1(CC2=CC=CC=C2)CCC[C@@H](O)C1 |
| CAS DataBase Reference | 91599-81-4(CAS DataBase Reference) |
Safety Information
| Hazard Codes | T |
| Risk Statements | 25-36/37/38 |
| Safety Statements | 26-45 |
| RIDADR | UN 2810 6.1/PG 3 |
| WGK Germany | 3 |
| HS Code | 29339900 |