tert-Butyl 5-norbornene-2-carboxylate
- Product Nametert-Butyl 5-norbornene-2-carboxylate
- CAS154970-45-3
- MFC12H18O2
- MW194.27
- EINECS
- MOL File154970-45-3.mol
Chemical Properties
| Boiling point | 243°C |
| Density | 1.046 |
| refractive index | 1.4580 to 1.4620 |
| Flash point | 92°C |
| storage temp. | Sealed in dry,Room Temperature |
| Appearance | Colorless to light yellow Liquid |
| InChI | InChI=1S/C12H18O2/c1-12(2,3)14-11(13)10-7-8-4-5-9(10)6-8/h4-5,8-10H,6-7H2,1-3H3 |
| InChIKey | BZBMBZJUNPMEBD-UHFFFAOYSA-N |
| SMILES | C12CC(C=C1)CC2C(OC(C)(C)C)=O |
| CAS DataBase Reference | 154970-45-3(CAS DataBase Reference) |
| EPA Substance Registry System | Bicyclo[2.2.1]hept-5-ene-2-carboxylic acid, 1,1-dimethylethyl ester (154970-45-3) |
Safety Information
| Safety Statements | 24/25 |
| TSCA | TSCA listed |
| HS Code | 29162090 |
