Chemical Properties
| Melting point | 300 °C |
| Density | 2.064g/cm3 at 20℃ |
| bulk density | 465kg/m3 |
| vapor pressure | 0Pa at 25℃ |
| storage temp. | Store at +15°C to +25°C. |
| solubility | 1350g/l |
| form | Powder |
| color | Off-white |
| PH | 5.0 (10g/l, H2O, 20℃) |
| Water Solubility | soluble |
| Sensitive | Hygroscopic |
| λmax | 290-291 nm (buffer pH 2.5) |
| Merck | 14,9465 |
| BRN | 4629740 |
| Stability | Stable. Incompatible with strong oxidizing agents. |
| InChI | 1S/C6H6O8S2.2Na/c7-4-1-3(15(9,10)11)2-5(6(4)8)16(12,13)14;;/h1-2,7-8H,(H,9,10,11)(H,12,13,14);;/q;2*+1/p-2 |
| InChIKey | ISWQCIVKKSOKNN-UHFFFAOYSA-L |
| SMILES | [Na+].[Na+].[S](=O)(=O)(O)c1c(c(cc(c1)[S](=O)(=O)O)[O-])[O-] |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | CZ9263000 |
| F | 3-9 |
| TSCA | TSCA listed |
| HS Code | 29082000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |
| Toxicity | mouse,LD50,intraperitoneal,6060mg/kg (6060mg/kg),Toxicology. Vol. 62, Pg. 203, 1990. |
