3-Nitro-1H-pyrazole
- Product Name3-Nitro-1H-pyrazole
- CAS26621-44-3
- MFC3H3N3O2
- MW113.07
- EINECS640-509-0
- MOL File26621-44-3.mol
Chemical Properties
| Melting point | 173-175 °C |
| Boiling point | 334.0±15.0 °C(Predicted) |
| Density | 1.552±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 8.32±0.10(Predicted) |
| color | White to Orange to Green |
| InChI | InChI=1S/C3H3N3O2/c7-6(8)3-1-2-4-5-3/h1-2H,(H,4,5) |
| InChIKey | MZRUFMBFIKGOAL-UHFFFAOYSA-N |
| SMILES | N1C=CC([N+]([O-])=O)=N1 |
| CAS DataBase Reference | 26621-44-3(CAS DataBase Reference) |
| NIST Chemistry Reference | 3(5)-nitropyrazole(26621-44-3) |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 22-26-36/37/39 |
| HazardClass | IRRITANT |
| HS Code | 2933199090 |
