Di-n-hexyl phthalate-3,4,5,6-d4
- Product NameDi-n-hexyl phthalate-3,4,5,6-d4
- CAS1015854-55-3
- MFC20H30O4
- MW334.46
- EINECS688-239-2
- MOL FileMol File
Chemical Properties
| solubility | Acetone (Slightly), Chloroform (Slightly), Methanol (Slightly) |
| form | Liquid |
| color | Colorless to light yellow |
| Major Application | cleaning products cosmetics environmental food and beverages personal care |
| InChI | 1S/C20H30O4/c1-3-5-7-11-15-23-19(21)17-13-9-10-14-18(17)20(22)24-16-12-8-6-4-2/h9-10,13-14H,3-8,11-12,15-16H2,1-2H3/i9D,10D,13D,14D |
| InChIKey | KCXZNSGUUQJJTR-LSQQNFJSSA-N |
| SMILES | [2H]c1c([2H])c([2H])c(C(=O)OCCCCCC)c(c1[2H])C(=O)OCCCCCC |
Safety Information
| Hazard Codes | T |
| Risk Statements | 61 |
| Safety Statements | 53-45 |
| WGK Germany | 3 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Repr. 1B |