![2-[Bis(4-hydroxyphenyl)methyl]benzyl alcohol Structure](/CAS/GIF/81-92-5.gif)
2-[Bis(4-hydroxyphenyl)methyl]benzyl alcohol
- Product Name2-[Bis(4-hydroxyphenyl)methyl]benzyl alcohol
- CAS81-92-5
- MFC20H18O3
- MW306.36
- EINECS201-386-5
- MOL File81-92-5.mol
Chemical Properties
| Melting point | 204 °C |
| Boiling point | 406.97°C (rough estimate) |
| Density | 1.1235 (rough estimate) |
| refractive index | 1.6630 (estimate) |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 9.86±0.10(Predicted) |
| color | White to Almost white |
| Merck | 14,7245 |
| InChI | InChI=1S/C20H18O3/c21-13-16-3-1-2-4-19(16)20(14-5-9-17(22)10-6-14)15-7-11-18(23)12-8-15/h1-12,20-23H,13H2 |
| InChIKey | CREICILGVGNQBH-UHFFFAOYSA-N |
| SMILES | C1(CO)=CC=CC=C1C(C1=CC=C(O)C=C1)C1=CC=C(O)C=C1 |
Safety Information
| RTECS | DA4912000 |
| HS Code | 2907.29.0500 |
| Toxicity | TDLo scu-rat: 160 mg/kg/18H JAFCAU 18,1108,1970 |
