4-Methylvaleryl chloride
- Product Name4-Methylvaleryl chloride
- CAS38136-29-7
- MFC6H11ClO
- MW134.6
- EINECS253-801-4
- MOL File38136-29-7.mol
Chemical Properties
| Boiling point | 144°C(lit.) |
| Density | 0.986±0.06 g/cm3(Predicted) |
| refractive index | 1.4230 to 1.4270 |
| form | clear liquid |
| color | Colorless to Light orange to Yellow |
| InChI | InChI=1S/C6H11ClO/c1-5(2)3-4-6(7)8/h5H,3-4H2,1-2H3 |
| InChIKey | SVWCVXFHTHCJJB-UHFFFAOYSA-N |
| SMILES | C(Cl)(=O)CCC(C)C |
| EPA Substance Registry System | Pentanoyl chloride, 4-methyl- (38136-29-7) |
Safety Information
| RIDADR | UN 2920 8/3/PG II |
| TSCA | TSCA listed |
| HazardClass | 8/3 |
| PackingGroup | II |
| HS Code | 2914790090 |
