3-Methyl-2-phenylpyridine
- Product Name3-Methyl-2-phenylpyridine
- CAS10273-90-2
- MFC12H11N
- MW169.22
- EINECS233-619-1
- MOL File10273-90-2.mol
Chemical Properties
| Boiling point | 148°C (16 mmHg) |
| Density | 1.065 |
| refractive index | 1.6010 to 1.6040 |
| Flash point | 96°C |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | 4.73±0.10(Predicted) |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| InChI | InChI=1S/C12H11N/c1-10-6-5-9-13-12(10)11-7-3-2-4-8-11/h2-9H,1H3 |
| InChIKey | BJATUPPYBZHEIO-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=CC=C2)=NC=CC=C1C |
| CAS DataBase Reference | 10273-90-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Pyridine, 3-methyl-2-phenyl-(10273-90-2) |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 36/37/38-41-37/38-22 |
| Safety Statements | 26-36/37/39 |
| HS Code | 2933399990 |
