3-Methyl-2-pyridone
- Product Name3-Methyl-2-pyridone
- CAS1003-56-1
- MFC6H7NO
- MW109.13
- EINECS213-710-2
- MOL File1003-56-1.mol
Chemical Properties
| Melting point | 139-141 °C |
| Boiling point | 204.59°C (rough estimate) |
| Density | 1.1143 (rough estimate) |
| refractive index | 1.5444 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Soluble in methanol. |
| form | powder to crystal |
| pka | 12.61±0.10(Predicted) |
| color | White to Orange to Green |
| BRN | 1422044 |
| InChI | InChI=1S/C6H7NO/c1-5-3-2-4-7-6(5)8/h2-4H,1H3,(H,7,8) |
| InChIKey | MVKDNXIKAWKCCS-UHFFFAOYSA-N |
| SMILES | C1(=O)NC=CC=C1C |
| CAS DataBase Reference | 1003-56-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 2(1H)-pyridinone, 3-methyl-(1003-56-1) |
Safety Information
| Hazard Codes | Xn,Xi |
| Risk Statements | 36/37/38-20/21/22-41-37/38-22 |
| Safety Statements | 36/37/39-26-22-36 |
| WGK Germany | 3 |
| HS Code | 29333995 |
