4-Iodobenzoyl chloride
- Product Name4-Iodobenzoyl chloride
- CAS1711-02-0
- MFC7H4ClIO
- MW266.46
- EINECS216-974-7
- MOL File1711-02-0.mol
Chemical Properties
| Melting point | 63-65 °C (lit.) |
| Boiling point | 120-121 °C/1 mmHg (lit.) |
| Density | 1.9367 (estimate) |
| Flash point | >110°C |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Soluble in toluene and benzene. |
| form | Crystalline Powder and Chunks or Crystalline Mass |
| color | Light yellow to beige |
| Sensitive | Moisture Sensitive |
| BRN | 774718 |
| InChI | InChI=1S/C7H4ClIO/c8-7(10)5-1-3-6(9)4-2-5/h1-4H |
| InChIKey | NJAKCIUOTIPYED-UHFFFAOYSA-N |
| SMILES | C(Cl)(=O)C1=CC=C(I)C=C1 |
| CAS DataBase Reference | 1711-02-0(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzoyl chloride, 4-iodo-(1711-02-0) |
| EPA Substance Registry System | Benzoyl chloride, 4-iodo- (1711-02-0) |
Safety Information
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 28A-26-45-36/37/39 |
| RIDADR | UN 3261 |
| WGK Germany | 3 |
| Hazard Note | Corrosive/Moisture Sensitive |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29163990 |
