trans-2-Hexenyl butyrate
- Product Nametrans-2-Hexenyl butyrate
- CAS53398-83-7
- MFC10H18O2
- MW170.25
- EINECS258-515-3
- MOL File53398-83-7.mol
Chemical Properties
| Boiling point | 190 °C(lit.) |
| Density | 0.885 g/mL at 25 °C(lit.) |
| FEMA | 3926 | TRANS-2-HEXENYL BUTYRATE |
| refractive index | n |
| Flash point | 186 °F |
| solubility | Insoluble in water, soluble in alcohol and oils. |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Odor | at 100.00 %. green fruity apricot ripe banana cortex orchid fermented |
| Odor Type | green |
| biological source | synthetic |
| JECFA Number | 1375 |
| Major Application | flavors and fragrances |
| Cosmetics Ingredients Functions | PERFUMING |
| InChI | 1S/C10H18O2/c1-3-5-6-7-9-12-10(11)8-4-2/h6-7H,3-5,8-9H2,1-2H3/b7-6+ |
| InChIKey | PCGACKLJNBBQGM-VOTSOKGWSA-N |
| SMILES | [H]\C(CCC)=C(\[H])COC(=O)CCC |
| LogP | 3.64 |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 2 |
| TSCA | TSCA listed |
| HS Code | 29156000 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |