6-Ethyl-3-oxa-6-azaoctanol
- Product Name6-Ethyl-3-oxa-6-azaoctanol
- CAS140-82-9
- MFC8H19NO2
- MW161.24
- EINECS205-436-7
- MOL File140-82-9.mol
Chemical Properties
| Boiling point | 101°C 1mm |
| Density | 0,94 g/cm3 |
| refractive index | 1.4470-1.4500 |
| Flash point | 96°C |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | clear liquid |
| pka | 14.39±0.10(Predicted) |
| color | Colorless to Light orange to Yellow |
| InChI | InChI=1S/C8H19NO2/c1-3-9(4-2)5-7-11-8-6-10/h10H,3-8H2,1-2H3 |
| InChIKey | VKBVRNHODPFVHK-UHFFFAOYSA-N |
| SMILES | C(O)COCCN(CC)CC |
| CAS DataBase Reference | 140-82-9(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-(2-Diethylaminoethoxy)-ethanol(140-82-9) |
| EPA Substance Registry System | 2-[2-(Diethylamino)ethoxy]ethanol (140-82-9) |
Safety Information
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 23-24/25-45-36/37/39-26 |
| WGK Germany | WGK 3 |
| TSCA | TSCA listed |
| HS Code | 2922500090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Dermal Eye Dam. 1 Skin Corr. 1B |
| Toxicity | rabbit,LD50,skin,2020uL/kg (2.02mL/kg),LIVER: OTHER CHANGESGASTROINTESTINAL: OTHER CHANGESSKIN AND APPENDAGES (SKIN): "DERMATITIS, OTHER: AFTER SYSTEMIC EXPOSURE",National Technical Information Service. Vol. OTS0535166, |
