5-Chloro-1-methylimidazole
- Product Name5-Chloro-1-methylimidazole
- CAS872-49-1
- MFC4H5ClN2
- MW116.55
- EINECS212-827-6
- MOL File872-49-1.mol
Chemical Properties
| Melting point | 82-85°C(11 mmHg) |
| Boiling point | 82-85 °C/11 mmHg (lit.) |
| Density | 1.25 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | 205 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Soluble in chloroform and insoluble in water |
| pka | 5.31±0.10(Predicted) |
| form | Oil |
| color | Colorless to yellow to brown liquid |
| Water Solubility | insoluble |
| BRN | 110509 |
| InChI | InChI=1S/C4H5ClN2/c1-7-3-6-2-4(7)5/h2-3H,1H3 |
| InChIKey | NYDGOZPYEABERA-UHFFFAOYSA-N |
| SMILES | C1N(C)C(Cl)=CN=1 |
| CAS DataBase Reference | 872-49-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 5-Chloro-1-methylimidazole(872-49-1) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2933299090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |