Dimethylketene methyl trimethylsilyl acetal
- Product NameDimethylketene methyl trimethylsilyl acetal
- CAS31469-15-5
- MFC8H18O2Si
- MW174.31
- EINECS629-515-4
- MOL File31469-15-5.mol
Chemical Properties
| Boiling point | 35 °C15 mm Hg(lit.) |
| Density | 0.858 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | 58 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | freely sol organic solvents. |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Specific Gravity | 0.858 |
| Water Solubility | Hydrolyzes in water. |
| Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents |
| Sensitive | Moisture Sensitive |
| BRN | 1362893 |
| Stability | Moisture and Acid Sensitive |
| InChI | 1S/C8H18O2Si/c1-7(2)8(9-3)10-11(4,5)6/h1-6H3 |
| InChIKey | JNOGVQJEBGEKMG-UHFFFAOYSA-N |
| SMILES | CO\C(O[Si](C)(C)C)=C(/C)C |
| CAS DataBase Reference | 31469-15-5(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 16-26-36 |
| RIDADR | UN 3271 3/PG 3 |
| WGK Germany | 3 |
| F | 10-21 |
| TSCA | TSCA listed |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29319090 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |
