2,3-Dimethylanthraquinone
- Product Name2,3-Dimethylanthraquinone
- CAS6531-35-7
- MFC16H12O2
- MW236.27
- EINECS
- MOL File6531-35-7.mol
Chemical Properties
| Melting point | 210-212 °C (lit.) |
| Boiling point | 338.73°C (rough estimate) |
| Density | 1.1223 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| form | powder to crystal |
| color | Light orange to Yellow to Green |
| InChI | 1S/C16H12O2/c1-9-7-13-14(8-10(9)2)16(18)12-6-4-3-5-11(12)15(13)17/h3-8H,1-2H3 |
| InChIKey | KIJPZYXCIHZVGP-UHFFFAOYSA-N |
| SMILES | Cc1cc2C(=O)c3ccccc3C(=O)c2cc1C |
| LogP | 4.300 (est) |
| CAS DataBase Reference | 6531-35-7(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HS Code | 2914.69.9000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
