2-Chloro-5-nitropyrimidine
- Product Name2-Chloro-5-nitropyrimidine
- CAS10320-42-0
- MFC4H2ClN3O2
- MW159.53
- EINECS233-703-8
- MOL File10320-42-0.mol
Chemical Properties
| Melting point | 105-110 °C |
| Boiling point | 345.4±15.0 °C(Predicted) |
| Density | 1.600±0.06 g/cm3(Predicted) |
| storage temp. | -20°C |
| form | powder to crystal |
| pka | -4.60±0.22(Predicted) |
| color | Light orange to Yellow to Green |
| InChI | InChI=1S/C4H2ClN3O2/c5-4-6-1-3(2-7-4)8(9)10/h1-2H |
| InChIKey | OFCBNMYNAHUDGE-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=C([N+]([O-])=O)C=N1 |
| CAS DataBase Reference | 10320-42-0(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-43-41-37/38-22-20/21/22 |
| Safety Statements | 26-36-37/39-36/37/39-36/37-24/25 |
| RIDADR | UN 3335 |
| WGK Germany | 3 |
| RTECS | US7175000 |
| HazardClass | IRRITANT |
| HS Code | 29335990 |
