Isonicotinoyl chloride hydrochloride
- Product NameIsonicotinoyl chloride hydrochloride
- CAS39178-35-3
- MFC6H5Cl2NO
- MW178.02
- EINECS254-331-2
- MOL File39178-35-3.mol
Chemical Properties
| Melting point | 159-161 °C(lit.) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | methanol: soluble50mg/mL, clear to hazy, colorless to light yellow |
| form | Crystalline Powder |
| color | Almost white to beige |
| Water Solubility | almost transparency |
| Sensitive | Moisture Sensitive |
| BRN | 3626052 |
| InChI | InChI=1S/C6H4ClNO.ClH/c7-6(9)5-1-3-8-4-2-5;/h1-4H;1H |
| InChIKey | BNTRVUUJBGBGLZ-UHFFFAOYSA-N |
| SMILES | C1(C(Cl)=O)=CC=NC=C1.Cl |
| CAS DataBase Reference | 39178-35-3(CAS DataBase Reference) |
Safety Information
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Corrosive |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29333990 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |