2,2'-Bipyrimidine
- Product Name2,2'-Bipyrimidine
- CAS34671-83-5
- MFC8H6N4
- MW158.16
- EINECS252-137-2
- MOL File34671-83-5.mol
Chemical Properties
| Melting point | 112-116 °C(lit.) |
| Boiling point | 395.4±25.0 °C(Predicted) |
| Density | 1.239 |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Soluble in methanol. |
| form | powder to crystal |
| pka | -1.22±0.33(Predicted) |
| color | White to Green to Brown |
| BRN | 607396 |
| InChI | InChI=1S/C8H6N4/c1-3-9-7(10-4-1)8-11-5-2-6-12-8/h1-6H |
| InChIKey | HKOAFLAGUQUJQG-UHFFFAOYSA-N |
| SMILES | C1(C2=NC=CC=N2)=NC=CC=N1 |
| CAS DataBase Reference | 34671-83-5(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29335990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |