3-Pentadecylphenol
- Product Name3-Pentadecylphenol
- CAS501-24-6
- MFC21H36O
- MW304.51
- EINECS207-921-9
- MOL File501-24-6.mol
Chemical Properties
| Melting point | 50-53 °C(lit.) |
| Boiling point | 190-195 °C1 mm Hg(lit.) |
| Density | 0.9096 (rough estimate) |
| refractive index | 1.4960 (estimate) |
| Flash point | >230 °F |
| storage temp. | 2-8°C |
| pka | 10.06±0.10(Predicted) |
| form | powder to lump |
| color | White to Gray to Brown |
| Major Application | food and beverages |
| InChI | InChI=1S/C21H36O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16-20-17-15-18-21(22)19-20/h15,17-19,22H,2-14,16H2,1H3 |
| InChIKey | PTFIPECGHSYQNR-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=CC(CCCCCCCCCCCCCCC)=C1 |
| CAS DataBase Reference | 501-24-6(CAS DataBase Reference) |
| EPA Substance Registry System | Phenol, 3-pentadecyl- (501-24-6) |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29071990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
