| Melting point |
46-48°C |
| Boiling point |
113-115°C 4mm |
| Density |
1.772±0.06 g/cm3(Predicted) |
| Flash point |
113-115°C/4mm |
| storage temp. |
under inert gas (nitrogen or Argon) at 2–8 °C |
| form |
powder to crystal |
| pka |
8.90±0.10(Predicted) |
| color |
White to Orange to Green |
| Water Solubility |
Slightly soluble in water. |
| Sensitive |
Light Sensitive/Air Sensitive |
| BRN |
2689605 |
| InChI |
InChI=1S/C7H8IN/c8-7-3-1-6(5-9)2-4-7/h1-4H,5,9H2 |
| InChIKey |
KCGZGJOBKAXVSU-UHFFFAOYSA-N |
| SMILES |
C1(CN)=CC=C(I)C=C1 |
| CAS DataBase Reference |
39959-59-6(CAS DataBase Reference) |
