4-Iodobenzylamine
- Product Name4-Iodobenzylamine
- CAS39959-59-6
- MFC7H8IN
- MW233.05
- EINECS638-924-7
- MOL File39959-59-6.mol
Chemical Properties
| Melting point | 46-48°C |
| Boiling point | 113-115°C 4mm |
| Density | 1.772±0.06 g/cm3(Predicted) |
| Flash point | 113-115°C/4mm |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| form | powder to crystal |
| pka | 8.90±0.10(Predicted) |
| color | White to Orange to Green |
| Water Solubility | Slightly soluble in water. |
| Sensitive | Light Sensitive/Air Sensitive |
| BRN | 2689605 |
| InChI | InChI=1S/C7H8IN/c8-7-3-1-6(5-9)2-4-7/h1-4H,5,9H2 |
| InChIKey | KCGZGJOBKAXVSU-UHFFFAOYSA-N |
| SMILES | C1(CN)=CC=C(I)C=C1 |
| CAS DataBase Reference | 39959-59-6(CAS DataBase Reference) |
Safety Information
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | 3259 |
| WGK Germany | WGK 3 |
| Hazard Note | Corrosive/Air Sensitive/Light Sensitive |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 2921490090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |