Vitexin-2-O-rhamnoside
- Product NameVitexin-2-O-rhamnoside
- CAS64820-99-1
- MFC27H30O14
- MW578.52
- EINECS251-228-4
- MOL File64820-99-1.mol
Chemical Properties
| Melting point | 215°C |
| Boiling point | 898.8±65.0 °C(Predicted) |
| Density | 1.74±0.1 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly), Water (Slightly) |
| pka | 6.21±0.40(Predicted) |
| form | Solid |
| color | Light Yellow to Yellow |
| Stability | Unstable in solution |
| Major Application | food and beverages |
| InChIKey | LYGPBZVKGHHTIE-HUBYJIGHSA-N |
| SMILES | C[C@@H]1O[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](CO)O[C@H]2c3c(O)cc(O)c4C(=O)C=C(Oc34)c5ccc(O)cc5)[C@H](O)[C@H](O)[C@H]1O |
| LogP | 1.860 (est) |
Safety Information
| WGK Germany | 3 |
| F | 10-21 |
| HS Code | 29389090 |
| Storage Class | 11 - Combustible Solids |
