2,3-Dihydroxyquinoxaline
- Product Name2,3-Dihydroxyquinoxaline
- CAS15804-19-0
- MFC8H6N2O2
- MW162.15
- EINECS239-901-0
- MOL File15804-19-0.mol
Chemical Properties
| Melting point | >300 °C (lit.) |
| Boiling point | 288.82°C (rough estimate) |
| Density | 1.3264 (rough estimate) |
| refractive index | 1.5770 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystaline |
| pka | 10.66±0.20(Predicted) |
| color | White to Orange to Green |
| BRN | 136884 |
| InChI | InChI=1S/C8H6N2O2/c11-7-8(12)10-6-4-2-1-3-5(6)9-7/h1-4H,(H,9,11)(H,10,12) |
| InChIKey | ABJFBJGGLJVMAQ-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=CC=C2)NC(=O)C1=O |
| CAS DataBase Reference | 15804-19-0(CAS DataBase Reference) |
| EPA Substance Registry System | 2,3-Quinoxalinedione, 1,4-dihydro- (15804-19-0) |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 22-37/38-41 |
| Safety Statements | 22-24/25-39-26 |
| WGK Germany | 3 |
| RTECS | VD2100000 |
| TSCA | TSCA listed |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
