| Boiling point |
337-466℃ |
| Density |
2.015-2.15 |
| vapor pressure |
0Pa at 25℃ |
| storage temp. |
Inert atmosphere,Room Temperature |
| solubility |
Soluble in water |
| form |
Fine Crystalline Powder |
| color |
Green |
| λmax |
374nm (H2O) |
| BRN |
3646090 |
| Major Application |
Assessing interaction between sulfonated polystyrene and poly(ethylacrylate-co4-vinylpyridine) ionomers;20 carbon nanotube;21 evaluating/studying influence of incorporation of counterions into polypyrrole; examining salt group association of sulfonated polystyrene ionomers; fabricating graphene-based nanoelectronic devices; graphene/polymer dispersions for graphene/polymer nanocomposites, organic solar cells, conductive films, ink-jet-printed electronic devices; graphene-zeolite based microcapsules; investigating electrical breakdown/permeability control of bilayer-corked capsule membrane; light filters; monitoring wastewater treatment; poly(arylene sulfide) blends in UV weathering; pulp and papermaking processes; thermosensitive polymer gels; thin films; TiO2-based materials; tracing corrosive materials; ureasil gels for water purification |
| Biological Applications |
Characterizing water-in-oil-in-water (W/O/W) emulsions; as a substrate for measuring lipase activity; air-breathing biocathodes for zinc/oxygen batteries; graphene-coated biochar for various environmental applications;plants or plant parts identification labels |
| InChIKey |
GQZOIEBZZPMPML-UHFFFAOYSA-N |
| SMILES |
S(C1C=C(S(O)(=O)=O)C2C=CC3C(=CC(S(O)(=O)=O)=C4C=CC=1C=2C=34)S(O)(=O)=O)(O)(=O)=O.[NaH] |
| LogP |
-4.5-0.899 at 20℃ and pH7 |
| CAS DataBase Reference |
59572-10-0(CAS DataBase Reference) |
| EPA Substance Registry System |
1,3,6,8-Pyrenetetrasulfonic acid, tetrasodium salt (59572-10-0) |