Chemical Properties
| Melting point | 271℃ (DEC.) |
| Boiling point | 662.4±55.0 °C(Predicted) |
| Density | 1.61 |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| solubility | Soluble in DMSO and water |
| form | powder |
| pka | 12.71±0.60(Predicted) |
| color | White |
| Major Application | food and beverages |
| InChI | 1S/C14H19NO8/c15-4-3-6-1-2-7(17)9(18)13(6)23-14-12(21)11(20)10(19)8(5-16)22-14/h1-3,7-14,16-21H,5H2/b6-3+ |
| InChIKey | WIIDBJNWXCWLKF-ZZXKWVIFSA-N |
| SMILES | N#C\C=C1\C(C(C(C=C\1)O)O)OC2OC(C(C(C2O)O)O)CO |
Safety Information
| Safety Statements | 24/25 |
| WGK Germany | WGK 3 |
| HS Code | 29389090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
