Ethylenesulfate
- Product NameEthylenesulfate
- CAS1072-53-3
- MFC2H4O4S
- MW124.12
- EINECS600-809-4
- MOL File1072-53-3.mol
Chemical Properties
| Melting point | 95-97 °C (lit.) |
| Boiling point | 231.1±7.0℃ (760 Torr) |
| Density | 1.604±0.06 g/cm3 (20 ºC 760 Torr) |
| vapor pressure | 0.91-1.7Pa at 20-25℃ |
| refractive index | 1.5090 (estimate) |
| Flash point | 93.5±18.2℃ |
| storage temp. | 2-8°C |
| solubility | Chloroform, Methanol |
| form | solid |
| color | White to Off-White |
| InChI | InChI=1S/C2H4O4S/c3-7(4)5-1-2-6-7/h1-2H2 |
| InChIKey | ZPFAVCIQZKRBGF-UHFFFAOYSA-N |
| SMILES | C1OS(=O)(=O)OC1 |
| LogP | -0.45 at 23℃ and pH1.4-1.7 |
| Surface tension | 66.8mN/m at 1g/L and 20℃ |
Safety Information
| Risk Statements | 22 |
| WGK Germany | 3 |
| RTECS | JH4800000 |
| HS Code | 29209085 |
| Storage Class | 8B - Non-combustible corrosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Carc. 2 Eye Dam. 1 Skin Corr. 1B Skin Sens. 1B |