4-Phenylpyrimidine
- Product Name4-Phenylpyrimidine
- CAS3438-48-0
- MFC10H8N2
- MW156.18
- EINECS222-345-8
- MOL File3438-48-0.mol
Chemical Properties
| Melting point | 54-58 °C (lit.) |
| Boiling point | 270.42°C (rough estimate) |
| Density | 1.1566 (rough estimate) |
| refractive index | 1.6057 (estimate) |
| Flash point | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 1.57±0.10(Predicted) |
| color | White to Yellow to Orange |
| InChI | InChI=1S/C10H8N2/c1-2-4-9(5-3-1)10-6-7-11-8-12-10/h1-8H |
| InChIKey | MKLQPIYLZMLAER-UHFFFAOYSA-N |
| SMILES | C1=NC=CC(C2=CC=CC=C2)=N1 |
Safety Information
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-36-22 |
| Safety Statements | 26-37/39-24/25 |
| WGK Germany | 3 |
| RTECS | UV9640000 |
| HS Code | 29335990 |
